20372-63-8
| Name | 4,5-Difluoro-2-nitrobenzoic acid |
| CAS | 20372-63-8 |
| EINECS(EC#) | 1533716-785-6 |
| Molecular Formula | C7H3F2NO4 |
| MDL Number | MFCD00799521 |
| Molecular Weight | 203.1 |
| MOL File | 20372-63-8.mol |
Chemical Properties
| Melting point | 165-167 °C (lit.) |
| Boiling point | 349.7±42.0 °C(Predicted) |
| density | 1.661±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 1.85±0.25(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C7H3F2NO4/c8-4-1-3(7(11)12)6(10(13)14)2-5(4)9/h1-2H,(H,11,12) |
| InChIKey | HGGRAOYTQNFGGN-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(F)c(F)cc1[N+]([O-])=O |
| CAS DataBase Reference | 20372-63-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
