
4325-85-3
| Name | TRIS(TRIMETHYLSILOXY)BORON |
| CAS | 4325-85-3 |
| EINECS(EC#) | -0 |
| Molecular Formula | C9H27BO3Si3 |
| MDL Number | MFCD00051588 |
| Molecular Weight | 278.38 |
| MOL File | 4325-85-3.mol |
Chemical Properties
| Appearance | Clear colorless liquid |
| Melting point | -35°C |
| Boiling point | 186 °C(lit.) |
| density | 0.831 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 109 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 0.828 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| BRN | 1772733 |
| InChI | InChI=1S/C9H27BO3Si3/c1-14(2,3)11-10(12-15(4,5)6)13-16(7,8)9/h1-9H3 |
| InChIKey | YZYKZHPNRDIPFA-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)OB(O[Si](C)(C)C)O[Si](C)(C)C |
| CAS DataBase Reference | 4325-85-3 |
| EPA Substance Registry System | Silanol, trimethyl-, triester with boric acid (H3BO3) (4325-85-3) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |

