
42074-68-0
| Name | 2-Chlorotritylchloride polymer resin |
| CAS | 42074-68-0 |
| EINECS(EC#) | 255-647-3 |
| Molecular Formula | C19H14Cl2 |
| MDL Number | MFCD00161760 |
| Molecular Weight | 313.226 |
| MOL File | 42074-68-0.mol |
Chemical Properties
| Appearance | off-white to yellow-brown beads |
| Melting point | 130-135 °C |
| Boiling point | 421.3±40.0 °C(Predicted) |
| density | 1.222±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform, methanol and dichloromethane, insoluble in water |
| form | Powder |
| color | Pale yellow crystalline powder |
| BRN | 1983914 |
| InChI | InChI=1S/C19H14Cl2/c20-18-14-8-7-13-17(18)19(21,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-14H |
| InChIKey | JFLSOKIMYBSASW-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=CC=C1C(Cl)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 42074-68-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Warning |
| Hazard statements | H290-H315-H319-H335 |
| Precautionary statements | P234-P261-P264-P271-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3261 |
| WGK Germany | 3 |
| F | 10-21 |
| REACH Registrations | Active |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Met. Corr. 1 Skin Irrit. 2 STOT SE 3 |

