
4093-31-6
| Name | Methyl 4-acetamido-5-chloro-2-methoxybenzoate |
| CAS | 4093-31-6 |
| EINECS(EC#) | 223-840-1 |
| Molecular Formula | C11H12ClNO4 |
| MDL Number | MFCD00048191 |
| Molecular Weight | 257.67 |
| MOL File | 4093-31-6.mol |
Chemical Properties
| Appearance | white to light beige fine crystalline powder |
| Melting point | 153-156 °C |
| Boiling point | 440.2±45.0 °C(Predicted) |
| density | 1.3248 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.16±0.70(Predicted) |
| color | White to Off-White |
| Water Solubility | 1.14g/L at 25℃ |
| InChI | InChI=1S/C11H12ClNO4/c1-6(14)13-9-5-10(16-2)7(4-8(9)12)11(15)17-3/h4-5H,1-3H3,(H,13,14) |
| InChIKey | OUEXNQRVYGYGIK-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(Cl)=C(NC(C)=O)C=C1OC |
| LogP | 1.49 at 20℃ |
| CAS DataBase Reference | 4093-31-6(CAS DataBase Reference) |
| EPA Substance Registry System | 4093-31-6(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
