4020-99-9
| Name | Diphenylmethoxyphosphine |
| CAS | 4020-99-9 |
| EINECS(EC#) | 223-683-9 |
| Molecular Formula | C13H13OP |
| MDL Number | MFCD00048025 |
| Molecular Weight | 216.22 |
| MOL File | 4020-99-9.mol |
Chemical Properties
| Appearance | Colorless to light yellow liqui |
| Boiling point | 149 °C6 mm Hg(lit.) |
| density | 1.078 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 0-6°C |
| form | Liquid |
| color | Clear colorless to very slightly yellow |
| Specific Gravity | 1.078 |
| Sensitive | Air & Moisture Sensitive |
| BRN | 1640480 |
| InChI | InChI=1S/C13H13OP/c1-14-15(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | OAADXJFIBNEPLY-UHFFFAOYSA-N |
| SMILES | P(C1=CC=CC=C1)(C1=CC=CC=C1)OC |
| CAS DataBase Reference | 4020-99-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl diphenylphosphinite(4020-99-9) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
