
3999-38-0
| Name | Borane-2-picoline complex |
| CAS | 3999-38-0 |
| EINECS(EC#) | 609-767-1 |
| Molecular Formula | C6H10BN |
| MDL Number | MFCD07784361 |
| Molecular Weight | 106.96 |
| MOL File | 3999-38-0.mol |
Chemical Properties
| Melting point | 48 °C |
| density | 1.297 g/mL at 25 °C |
| Fp | 100°(212°F) |
| storage temp. | 2-8°C |
| solubility | Dichloromethane (Sparingly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White |
| Water Solubility | Slightly sol. in water, cyclohexane, very sol. in methanol, THF, diglyme, and benzene |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C6H10BN/c1-6-4-2-3-5-8(6)7/h2-5H,1,7H3 |
| InChIKey | ZMASBEFBIXMNCP-UHFFFAOYSA-N |
| SMILES | [B+3](N1=CC=CC=C1C)([H-])([H-])[H-] |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H261-H315-H319-H335 |
| Precautionary statements | P231+P232-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3130 6.1(4.3) / PGII |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HazardClass | 4.3 |
| PackingGroup | II |
| HS Code | 29333990 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 Water-react 2 |

