39830-66-5
| Name | Methyl indole-4-carboxylate |
| CAS | 39830-66-5 |
| EINECS(EC#) | 622-802-5 |
| Molecular Formula | C10H9NO2 |
| MDL Number | MFCD00191222 |
| Molecular Weight | 175.18 |
| MOL File | 39830-66-5.mol |
Chemical Properties
| Appearance | off-white to green crystalline powder |
| Melting point | 68-71 °C(lit.) |
| Boiling point | 306.47°C (rough estimate) |
| density | 1.1999 (rough estimate) |
| refractive index | 1.5060 (estimate) |
| storage temp. | 0-6°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 15.80±0.30(Predicted) |
| color | Off-white to green |
| Detection Methods | GC,NMR |
| BRN | 141826 |
| InChI | InChI=1S/C10H9NO2/c1-13-10(12)8-3-2-4-9-7(8)5-6-11-9/h2-6,11H,1H3 |
| InChIKey | WEAXQUBYRSEBJD-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(C(OC)=O)=CC=C2)C=C1 |
| CAS DataBase Reference | 39830-66-5(CAS DataBase Reference) |
| Storage Precautions | Light sensitive |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
