1074-86-8
| Name | Indole-4-carboxaldehyde |
| CAS | 1074-86-8 |
| EINECS(EC#) | 625-162-5 |
| Molecular Formula | C9H7NO |
| MDL Number | MFCD01632221 |
| Molecular Weight | 145.16 |
| MOL File | 1074-86-8.mol |
Chemical Properties
| Melting point | 139-143 °C(lit.) |
| Boiling point | 339.1±15.0 °C(Predicted) |
| density | 1.278±0.06 g/cm3(Predicted) |
| storage temp. | Keep Cold |
| solubility | DMF: 10 mg/ml; DMSO: 3 mg/ml; Ethanol: 10 mg/ml; Ethanol:PBS(pH 7.2) (1:1): 0.5 mg/ml |
| form | powder to crystal |
| pka | 15.84±0.30(Predicted) |
| color | Light yellow to Brown |
| Water Solubility | Soluble in ethanol and acetone. Insoluble in water. |
| Sensitive | Air Sensitive |
| Detection Methods | HPLC,NMR |
| InChI | InChI=1S/C9H7NO/c11-6-7-2-1-3-9-8(7)4-5-10-9/h1-6,10H |
| InChIKey | JFDDFGLNZWNJTK-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(C=O)=CC=C2)C=C1 |
| CAS DataBase Reference | 1074-86-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-indole-4-carboxaldehyde(1074-86-8) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |