33630-99-8
| Name | 3-Amino-2-pyridinol |
| CAS | 33630-99-8 |
| Molecular Formula | C5H6N2O |
| MDL Number | MFCD03411556 |
| Molecular Weight | 110.11 |
| MOL File | 33630-99-8.mol |
Chemical Properties
| Appearance | Brown to off-white crystalline powder. |
| Melting point | 118-130 °C |
| Boiling point | 206.4°C (rough estimate) |
| density | 1.2111 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| form | Powder |
| pka | 13.87±0.10(Predicted) |
| color | Dark brown to black |
| Water Solubility | Slightly soluble in water. |
| Detection Methods | HPLC |
| InChI | InChI=1S/C5H6N2O/c6-4-2-1-3-7-5(4)8/h1-3H,6H2,(H,7,8) |
| InChIKey | VTSFNCCQCOEPKF-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC=C1N |
| CAS DataBase Reference | 33630-99-8(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
