
33467-74-2
| Name | CIS-3-HEXENYL PROPIONATE |
| CAS | 33467-74-2 |
| EINECS(EC#) | 251-533-2 |
| Molecular Formula | C9H16O2 |
| MDL Number | MFCD00036534 |
| Molecular Weight | 156.22 |
| MOL File | 33467-74-2.mol |
Chemical Properties
| Melting point | -57.45°C (estimate) |
| Boiling point | 83 °C/17 mmHg(lit.) |
| density | 0.887 g/mL at 25 °C(lit.) |
| FEMA | 3933 |
| refractive index | n20/D 1.43(lit.) |
| Fp | 66 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| Appearance | Colorless to light yellow Liquid |
| Odor | at 100.00 %. green fresh fruity apple pear vegetable melon banana peach |
| biological source | synthetic |
| Odor Type | green |
| JECFA Number | 1274 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C9H16O2/c1-3-5-6-7-8-11-9(10)4-2/h5-6H,3-4,7-8H2,1-2H3/b6-5- |
| InChIKey | LGTLDEUQCOJGFP-WAYWQWQTSA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)CC |
| LogP | 2.95 |
| CAS DataBase Reference | 33467-74-2(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | MP8645100 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
