
67526-95-8
| Name | THAPSIGARGIN |
| CAS | 67526-95-8 |
| EINECS(EC#) | 614-076-3 |
| Molecular Formula | C34H50O12 |
| MDL Number | MFCD00083511 |
| Molecular Weight | 650.75 |
| MOL File | 67526-95-8.mol |
Chemical Properties
| Appearance | colourless film |
| Boiling point | 597.77°C (rough estimate) |
| density | 1.1521 (rough estimate) |
| refractive index | 1.6390 (estimate) |
| RTECS | RH0325700 |
| storage temp. | −20°C |
| solubility | DMSO: soluble |
| form | liquid or film |
| pka | 10.57±0.70(Predicted) |
| color | Colorless |
| biological source | plant (Thapsia garganica) |
| Sensitive | Light Sensitive |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 1 week. |
| InChIKey | IXFPJGBNCFXKPI-FSIHEZPISA-N |
| SMILES | [H][C@@]12C([C@H](OC([C@]3(O)C)=O)[C@]3(O)[C@@H](OC(CCC)=O)C[C@]2(C)OC(C)=O)=C(C)[C@H](OC(/C(C)=C(C)/[H])=O)[C@H]1OC(CCCCCCC)=O |
| CAS DataBase Reference | 67526-95-8(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 STOT SE 3 |