16491-36-4
| Name | CIS-3-HEXENYL BUTYRATE |
| CAS | 16491-36-4 |
| EINECS(EC#) | 240-553-7 |
| Molecular Formula | C10H18O2 |
| MDL Number | MFCD00036540 |
| Molecular Weight | 170.25 |
| MOL File | 16491-36-4.mol |
Chemical Properties
| Boiling point | 96 °C20 mm Hg(lit.) |
| density | 0.885 g/mL at 25 °C(lit.) |
| FEMA | 3402 |
| refractive index | n |
| Fp | 174 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| Specific Gravity | 0.885 |
| Appearance | Colorless to light yellow Liquid |
| Odor | at 100.00 %. fresh green apple fruity wine metallic buttery |
| biological source | synthetic |
| Odor Type | green |
| JECFA Number | 157 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H18O2/c1-3-5-6-7-9-12-10(11)8-4-2/h5-6H,3-4,7-9H2,1-2H3/b6-5- |
| InChIKey | ZCHOPXVYTWUHDS-WAYWQWQTSA-N |
| SMILES | [H]\C(CC)=C(/[H])CCOC(=O)CCC |
| LogP | 3.48 |
| CAS DataBase Reference | 16491-36-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |