
30827-99-7
| Name | 4-(2-Aminoethyl)benzenesulfonylfluoride hydrochloride |
| CAS | 30827-99-7 |
| EINECS(EC#) | 608-547-2 |
| Molecular Formula | C8H11ClFNO2S |
| MDL Number | MFCD00132962 |
| Molecular Weight | 239.69 |
| MOL File | 30827-99-7.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | 175-177 °C |
| bulk density | 200kg/m3 |
| storage temp. | 0-6°C |
| solubility | H2O: soluble50mg/mL (stable for up to six months if stored refrigerated at a pH of less than 7. If a pH of greater than 7 is required, pH adjustment should be made just prior to use.) |
| form | Powder |
| color | White |
| PH | pH3.0~5.0 (10g/L, 25℃) |
| biological source | synthetic (organic) |
| Water Solubility | 10 g/L (20 ºC) |
| Sensitive | Moisture Sensitive |
| BRN | 7604627 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions at pH <7 are stable for up to 6 months if stored in the refrigerator |
| InChI | InChI=1S/C8H10FNO2S.ClH/c9-13(11,12)8-3-1-7(2-4-8)5-6-10;/h1-4H,5-6,10H2;1H |
| InChIKey | WRDABNWSWOHGMS-UHFFFAOYSA-N |
| SMILES | S(C1C=CC(CCN)=CC=1)(=O)(=O)F.Cl |
| CAS DataBase Reference | 30827-99-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | C,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29214990 |
