28733-43-9
| Name | 5-Bromonicotinamide |
| CAS | 28733-43-9 |
| EINECS(EC#) | 244-065-5 |
| Molecular Formula | C6H5BrN2O |
| MDL Number | MFCD00173919 |
| Molecular Weight | 201.02 |
| MOL File | 28733-43-9.mol |
Chemical Properties
| Appearance | Off-white to light pink powder |
| Melting point | 219-223 °C |
| Boiling point | 315.5±27.0 °C(Predicted) |
| density | 1.710±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| pka | 14.21±0.50(Predicted) |
| color | Off-white to light pink |
| InChI | InChI=1S/C6H5BrN2O/c7-5-1-4(6(8)10)2-9-3-5/h1-3H,(H2,8,10) |
| InChIKey | YOQRXZIMSKLRCY-UHFFFAOYSA-N |
| SMILES | C1=NC=C(Br)C=C1C(N)=O |
| CAS DataBase Reference | 28733-43-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | QS4170000 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |