2818-66-8
| Name | 5-Amino-2-benzimidazolethiol |
| CAS | 2818-66-8 |
| EINECS(EC#) | 220-574-8 |
| Molecular Formula | C7H7N3S |
| MDL Number | MFCD00022671 |
| Molecular Weight | 165.22 |
| MOL File | 2818-66-8.mol |
Chemical Properties
| Appearance | off-white to light yellow crystalline powder |
| Melting point | 240-244 °C (lit.) |
| Boiling point | 356.8±44.0 °C(Predicted) |
| density | 1.2404 (rough estimate) |
| refractive index | 1.5605 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| form | powder to crystal |
| pka | 10.44±0.30(Predicted) |
| color | Light yellow to Amber to Dark green |
| Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C |
| InChI | InChI=1S/C7H7N3S/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,8H2,(H2,9,10,11) |
| InChIKey | BXDMTLVCACMNJO-UHFFFAOYSA-N |
| SMILES | C1(=S)NC2=CC=C(N)C=C2N1 |
| CAS DataBase Reference | 2818-66-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2818-66-8(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |