934-22-5
| Name | 1H-BENZOIMIDAZOL-5-YLAMINE |
| CAS | 934-22-5 |
| EINECS(EC#) | 213-279-0 |
| Molecular Formula | C7H7N3 |
| MDL Number | MFCD00465258 |
| Molecular Weight | 133.15 |
| MOL File | 934-22-5.mol |
Chemical Properties
| Melting point | 163-168 °C |
| Boiling point | 222°C/3.5mmHg(lit.) |
| density | 1.367 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| pka | 14.47±0.30(Predicted) |
| color | Light yellow to Brown |
| λmax | 300nm(EtOH)(lit.) |
| InChI | InChI=1S/C7H7N3/c8-5-1-2-6-7(3-5)10-4-9-6/h1-4H,8H2,(H,9,10) |
| InChIKey | WFRXSXUDWCVSPI-UHFFFAOYSA-N |
| SMILES | C1NC2=CC(N)=CC=C2N=1 |
| CAS DataBase Reference | 934-22-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DD5785000 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
