2800-80-8
| Name | Bromophenol Red |
| CAS | 2800-80-8 |
| EINECS(EC#) | 220-538-1 |
| Molecular Formula | C19H12Br2O5S |
| MDL Number | MFCD00023014 |
| Molecular Weight | 512.17 |
| MOL File | 2800-80-8.mol |
Chemical Properties
| Appearance | red-brown to brown powder |
| Melting point | >250°C |
| Boiling point | 586.8±50.0 °C(Predicted) |
| bulk density | 770kg/m3 |
| density | 1.881±0.06 g/cm3(Predicted) |
| storage temp. | Store at +5°C to +30°C. |
| solubility | Solubility Sparingly soluble in water; soluble in ethanol |
| form | Powder |
| pka | 6.51(at 25℃) |
| color | Red-brown to brown |
| PH | pH : 5.2～7.0 |
| PH Range | 5.2(orange/yellow)-6.8(purple) |
| λmax | 574nm |
| Major Application | Sensors, sol-gel matrix, recording materials, thermochromic materials, inks, paints, alloy coatings, lubricants, soaps, cosmetics, identifying fresh & stale rice, acidity in wine, food storage, determination of bacterial growth, antiamyloid agents, evaluating dental caries activity, determination of Streptococci in human saliva, diagnosis of enterohemorrhagic Escherichia coli, treatment of acute leukemia |
| InChI | 1S/C19H12Br2O5S/c20-14-9-11(5-7-16(14)22)19(12-6-8-17(23)15(21)10-12)13-3-1-2-4-18(13)27(24,25)26-19/h1-10,22-23H |
| InChIKey | OYCLSQDXZMROJK-UHFFFAOYSA-N |
| SMILES | [S]1(=O)(=O)OC(c4c1cccc4)(c3cc(c(cc3)O)Br)c2cc(c(cc2)O)Br |
| CAS DataBase Reference | 2800-80-8(CAS DataBase Reference) |