2713-34-0
| Name | 3,5-Difluorophenol |
| CAS | 2713-34-0 |
| EINECS(EC#) | 608-047-4 |
| Molecular Formula | C6H4F2O |
| MDL Number | MFCD00002255 |
| Molecular Weight | 130.09 |
| MOL File | 2713-34-0.mol |
Chemical Properties
| Appearance | white to beige crystals |
| Melting point | 54-57 °C (lit.) |
| Boiling point | 65-68°C 1mm |
| density | 1.2483 (estimate) |
| Fp | 159 °F |
| storage temp. | Flammables area |
| solubility | ethanol: soluble50, clear, colorless to faint yellow or tan (mg/mL) |
| form | Crystals |
| pka | 7.97±0.10(Predicted) |
| color | White to beige |
| BRN | 2078616 |
| InChI | InChI=1S/C6H4F2O/c7-4-1-5(8)3-6(9)2-4/h1-3,9H |
| InChIKey | HJSSBIMVTMYKPD-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 2713-34-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Difluorophenol(2713-34-0) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi,C,F |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29081900 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
