
6418-38-8
| Name | 2,3-Difluorophenol |
| CAS | 6418-38-8 |
| EINECS(EC#) | 264-750-2 |
| Molecular Formula | C6H4F2O |
| MDL Number | MFCD00010262 |
| Molecular Weight | 130.09 |
| MOL File | 6418-38-8.mol |
Chemical Properties
| Appearance | white crystalline low melting mass |
| Melting point | 39-42 °C (lit.) |
| Boiling point | 54 °C/25 mmHg (lit.) |
| density | 1.2483 (estimate) |
| Fp | 134 °F |
| storage temp. | Flammables area |
| form | powder to lump to clear liquid |
| pka | 7.71±0.10(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| Usage | Intermediates of Liquid Crystals |
| BRN | 2082265 |
| InChI | InChI=1S/C6H4F2O/c7-4-2-1-3-5(9)6(4)8/h1-3,9H |
| InChIKey | RPEPGIOVXBBUMJ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(F)=C1F |
| CAS DataBase Reference | 6418-38-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H302-H315-H319-H335 |
| Precautionary statements | P210-P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | F,Xn,Xi,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29081900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |

