769-39-1
| Name | 2,3,5,6-Tetrafluorophenol |
| CAS | 769-39-1 |
| EINECS(EC#) | 212-209-6 |
| Molecular Formula | C6H2F4O |
| MDL Number | MFCD00002157 |
| Molecular Weight | 166.07 |
| MOL File | 769-39-1.mol |
Chemical Properties
| Appearance | white solid |
| Melting point | 37-39 °C (lit.) |
| Boiling point | 140 °C (lit.) |
| density | 1.4445 (estimate) |
| Fp | 175 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Low Melting Solid |
| pka | 5.46±0.20(Predicted) |
| color | White |
| Stability: | Stable. Incompatible with acid chlorides, acid anhydrides, oxidizing agents. |
| Water Solubility | Partly miscible with water. |
| BRN | 1911548 |
| InChI | InChI=1S/C6H2F4O/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H |
| InChIKey | PBYIIRLNRCVTMQ-UHFFFAOYSA-N |
| SMILES | C1(O)=C(F)C(F)=CC(F)=C1F |
| CAS DataBase Reference | 769-39-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3,5,6-Tetrafluorophenol(769-39-1) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29081990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
