2695-37-6
| Name | Sodium p-styrenesulfonate |
| CAS | 2695-37-6 |
| EINECS(EC#) | 220-266-3 |
| Molecular Formula | C8H7NaO3S |
| MDL Number | MFCD03092905 |
| Molecular Weight | 206.19 |
| MOL File | 2695-37-6.mol |
Chemical Properties
| Appearance | white to light beige powder |
| Melting point | 151-154 °C |
| Boiling point | 111-112 °C |
| density | 1.043 g/mL at 25 °C |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Fp | 78 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| color | White |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | Soluble in water. |
| Hydrolytic Sensitivity | 0: forms stable aqueous solutions |
| BRN | 3575931 |
| InChI | 1S/C8H8O3S.Na/c1-2-7-3-5-8(6-4-7)12(9,10)11;/h2-6H,1H2,(H,9,10,11);/q;+1/p-1 |
| InChIKey | XFTALRAZSCGSKN-UHFFFAOYSA-M |
| SMILES | [Na+].[O-]S(=O)(=O)c1ccc(C=C)cc1 |
| LogP | -3.44 at 24℃ |
| CAS DataBase Reference | 2695-37-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |    GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H315-H318-H335-H336 |
| Precautionary statements | P210-P280-P305+P351+P338+P310-P370+P378 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| F | 8-23 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |