26250-84-0
| Name | (S)-1-Boc-piperidine-2-carboxylic acid |
| CAS | 26250-84-0 |
| Molecular Formula | C11H19NO4 |
| MDL Number | MFCD00151904 |
| Molecular Weight | 229.27 |
| MOL File | 26250-84-0.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 122-126 °C(lit.) |
| alpha | -63.2 º (c=1 in acetic acid) |
| Boiling point | 353.2±35.0 °C(Predicted) |
| density | 1.164±0.06 g/cm3(Predicted) |
| storage temp. | Store at RT. |
| solubility | Chloroform, Methanol |
| form | Powder |
| pka | 4.03±0.20(Predicted) |
| color | White to off-white |
| Optical Rotation | [α]23/D 63.2°, c = 1 in acetic acid |
| Water Solubility | Insoluble in water. |
| BRN | 3652038 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)12-7-5-4-6-8(12)9(13)14/h8H,4-7H2,1-3H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | JQAOHGMPAAWWQO-QMMMGPOBSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC[C@H]1C(O)=O |
| CAS DataBase Reference | 26250-84-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |