
2374-03-0
| Name | 4-Amino-3-hydroxybenzoic acid |
| CAS | 2374-03-0 |
| Molecular Formula | C7H7NO3 |
| MDL Number | MFCD00017094 |
| Molecular Weight | 153.14 |
| MOL File | 2374-03-0.mol |
Chemical Properties
| Appearance | yellow-brown to brown crystalline powder |
| Melting point | 211-215 °C (lit.) |
| Boiling point | 385.7±37.0 °C(Predicted) |
| density | 1.028 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 4.74±0.10(Predicted) |
| color | Yellow-brown to brown |
| Water Solubility | Soluble in chloroform, and aqeous ethanol, water (Partly miscible) |
| BRN | 509859 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H7NO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,8H2,(H,10,11) |
| InChIKey | NFPYJDZQOKCYIE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N)C(O)=C1 |
| CAS DataBase Reference | 2374-03-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
