23735-43-5
| Name | (S)-2,2-Dimethyl-1,3-dioxolane-4-methanol p-toluenesulfonate |
| CAS | 23735-43-5 |
| Molecular Formula | C13H18O5S |
| MDL Number | MFCD00063234 |
| Molecular Weight | 286.34 |
| MOL File | 23735-43-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 29-31 °C |
| alpha | 4.2 º (c=10, abs.alcohol) |
| Boiling point | 398.71°C (rough estimate) |
| density | 1.208 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Optical Rotation | [α]26/D +7.5°, c = 2% in DMF |
| BRN | 89799 |
| InChI | InChI=1/C13H18O5S/c1-10-4-6-12(7-5-10)19(14,15)17-9-11-8-16-13(2,3)18-11/h4-7,11H,8-9H2,1-3H3/t11-/s3 |
| InChIKey | SRKDUHUULIWXFT-LBPXTSNRNA-N |
| SMILES | C1(C=CC(C)=CC=1)S(=O)(=O)OC[C@@H]1COC(C)(C)O1 |&1:12,r| |
| CAS DataBase Reference | 23735-43-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
