22918-01-0
| Name | 2-Bromo-4-chloropyridine |
| CAS | 22918-01-0 |
| Molecular Formula | C5H3BrClN |
| MDL Number | MFCD03840757 |
| Molecular Weight | 192.44 |
| MOL File | 22918-01-0.mol |
Chemical Properties
| Appearance | Light yellow liquid |
| Melting point | <30℃ |
| Boiling point | 98°C |
| density | 1.736±0.06 g/cm3(Predicted) |
| Fp | >110℃ |
| storage temp. | -20°C |
| solubility | soluble in Methanol |
| form | powder to lump to clear liquid |
| pka | 0.12±0.10(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| InChI | InChI=1S/C5H3BrClN/c6-5-3-4(7)1-2-8-5/h1-3H |
| InChIKey | SURKZMFXICWLHU-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=CC(Cl)=C1 |
| CAS DataBase Reference | 22918-01-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 1 |
| HS Code | 2933399990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |