22536-65-8
| Name | 2-Chloro-5-methoxypyrimidine |
| CAS | 22536-65-8 |
| EINECS(EC#) | 636-584-4 |
| Molecular Formula | C5H5ClN2O |
| MDL Number | MFCD08702770 |
| Molecular Weight | 144.56 |
| MOL File | 22536-65-8.mol |
Chemical Properties
| Melting point | 73-78℃ |
| Boiling point | 268.8±13.0 °C(Predicted) |
| density | 1.292±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -1.26±0.22(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C5H5ClN2O/c1-9-4-2-7-5(6)8-3-4/h2-3H,1H3 |
| InChIKey | RSUBGBZOMBTDTI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(OC)C=N1 |
| CAS DataBase Reference | 22536-65-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
