
22288-78-4
| Name | Methyl 3-amino-2-thiophenecarboxylate |
| CAS | 22288-78-4 |
| EINECS(EC#) | 244-895-8 |
| Molecular Formula | C6H7NO2S |
| MDL Number | MFCD00009765 |
| Molecular Weight | 157.19 |
| MOL File | 22288-78-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 62-64 °C (lit.) |
| Boiling point | 100-102 °C/0.1 mmHg (lit.) |
| density | 1.274 (estimate) |
| refractive index | 1.5500 (estimate) |
| Fp | 100-102°C/0.1mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in alcohol, toluene, xylene and other solvents |
| form | Fine Crystalline Powder |
| pka | 1.86±0.10(Predicted) |
| color | Beige to beige-brown |
| Water Solubility | Slightly soluble in water. |
| Detection Methods | HPLC,NMR |
| BRN | 1365614 |
| InChI | InChI=1S/C6H7NO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,7H2,1H3 |
| InChIKey | TWEQNZZOOFKOER-UHFFFAOYSA-N |
| SMILES | C1(C(OC)=O)SC=CC=1N |
| CAS DataBase Reference | 22288-78-4(CAS DataBase Reference) |
| EPA Substance Registry System | 22288-78-4(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | XM8347500 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | IRRITANT |
| HS Code | 29349900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
