2160-62-5
| Name | 5-BROMOTHIOPHENE-2-CARBONITRILE |
| CAS | 2160-62-5 |
| Molecular Formula | C5H2BrNS |
| MDL Number | MFCD04974080 |
| Molecular Weight | 188.05 |
| MOL File | 2160-62-5.mol |
Chemical Properties
| Boiling point | 124°C/34mmHg(lit.) |
| density | 1.694 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 214 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.619 |
| λmax | 276nm(Benzene)(lit.) |
| InChI | InChI=1S/C5H2BrNS/c6-5-2-1-4(3-7)8-5/h1-2H |
| InChIKey | YVVHCBNJWHPMCQ-UHFFFAOYSA-N |
| SMILES | C1(C#N)SC(Br)=CC=1 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3267 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
