
7311-63-9
| Name | 5-Bromo-2-thiophenecarboxylic acid |
| CAS | 7311-63-9 |
| EINECS(EC#) | 615-911-4 |
| Molecular Formula | C5H3BrO2S |
| MDL Number | MFCD00079725 |
| Molecular Weight | 207.05 |
| MOL File | 7311-63-9.mol |
Chemical Properties
| Appearance | White to light yellow crystal powder |
| Melting point | 140 °C |
| Boiling point | 318.9±27.0 °C(Predicted) |
| density | 1.923±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Crystalline Powder |
| pka | 3.32±0.10(Predicted) |
| color | White to cream |
| Detection Methods | HPLC |
| BRN | 118364 |
| InChI | InChI=1S/C5H3BrO2S/c6-4-2-1-3(9-4)5(7)8/h1-2H,(H,7,8) |
| InChIKey | COWZPSUDTMGBAT-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC(Br)=CC=1 |
| CAS DataBase Reference | 7311-63-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
