214360-73-3
| Name | 4-Aminophenylboronic acid pinacol ester |
| CAS | 214360-73-3 |
| EINECS(EC#) | 629-061-7 |
| Molecular Formula | C12H20BNO3 |
| MDL Number | MFCD02258965 |
| Molecular Weight | 237.1 |
| MOL File | 214360-73-3.mol |
Chemical Properties
| Appearance | almost white to light beige crystalline powder |
| Melting point | 165-169 °C (lit.) |
| Boiling point | 340.0±25.0 °C(Predicted) |
| density | 1.05±0.1 g/cm3(Predicted) |
| storage temp. | Refrigerator (+4°C) |
| solubility | Chloroform |
| form | Crystalline Powder |
| pka | 4.24±0.10(Predicted) |
| color | Almost white to light beige |
| Water Solubility | Insoluble |
| InChI | InChI=1S/C12H18BNO2/c1-11(2)12(3,4)16-13(15-11)9-5-7-10(14)8-6-9/h5-8H,14H2,1-4H3 |
| InChIKey | ZANPJXNYBVVNSD-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(B2OC(C)(C)C(C)(C)O2)C=C1 |
| CAS DataBase Reference | 214360-73-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | No |
| HazardClass | IRRITANT |
| HS Code | 29349900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
