21145-77-7
| Name | 6-ACETYL-1,1,2,4,4,7-HEXAMETHYLTETRALIN |
| CAS | 21145-77-7 |
| EINECS(EC#) | 244-240-6 |
| Molecular Formula | C18H26O |
| MDL Number | MFCD00437355 |
| Molecular Weight | 258.4 |
| MOL File | 21145-77-7.mol |
Chemical Properties
| Appearance | Off-White Powder |
| Melting point | 550C |
| Boiling point | 124 °C(Press: 1 Torr) |
| density | 0.919±0.06 g/cm3(Predicted) |
| vapor pressure | 0.068Pa at 25℃ |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Solid |
| color | White to Off-White |
| Odor | musky, warm, radiant, tenacious odor |
| Henry's Law Constant | 7.0×10-2 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE |
| InChI | 1S/C18H26O/c1-11-8-16-15(9-14(11)13(3)19)17(4,5)10-12(2)18(16,6)7/h8-9,12H,10H2,1-7H3 |
| InChIKey | DNRJTBAOUJJKDY-UHFFFAOYSA-N |
| SMILES | CC1CC(C)(C)c2cc(C(C)=O)c(C)cc2C1(C)C |
| LogP | 5.4 at 25℃ |
| CAS DataBase Reference | 21145-77-7 |
| NIST Chemistry Reference | Ethanone, 1-(5,6,7,8-tetrahydro-3,5,5,6,8,8-hexamethyl-2-naphthalenyl)-(21145-77-7) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | |
| WGK Germany | 3 |
| RTECS | KM5805024 |
| TSCA | TSCA listed |
| REACH Registrations | Inactive |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 21145-77-7(Hazardous Substances Data) |