
1222-05-5
| Name | GALAXOLIDE |
| CAS | 1222-05-5 |
| EINECS(EC#) | 214-946-9 |
| Molecular Formula | C18H26O |
| MDL Number | MFCD00217003 |
| Molecular Weight | 258.4 |
| MOL File | 1222-05-5.mol |
Chemical Properties
| Melting point | 57-58° |
| Boiling point | 304 °C(lit.) |
| density | 1.044 g/mL at 25 °C(lit.) |
| vapor pressure | 0.073Pa at 25℃ |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| Odor | at 100.00 %. strong diffusive sweet floral musk |
| Odor Type | musk |
| Water Solubility | 1.65mg/L at 25℃ |
| Henry's Law Constant | 7.6×10-2 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | PERFUMING FRAGRANCE |
| InChI | 1S/C18H26O/c1-11-14-10-16-15(9-13(14)7-8-19-11)17(3,4)12(2)18(16,5)6/h9-12H,7-8H2,1-6H3 |
| InChIKey | YWMTVUUYOAIDBC-UHFFFAOYSA-N |
| SMILES | CC1(C)C(C)C(C)(C)C2=CC3=C(C(C)COC3)C=C21 |
| LogP | 5.3 at 25℃ |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H317-H320-H335+H336-H410 |
| Precautionary statements | P273-P391-P501-P261-P264-P271-P272-P280-P302+P352+P333+P313+P363-P304+P340+P312-P305+P351+P338+P337+P313-P403+P233-P405 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2932.99.7000 |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 1222-05-5(Hazardous Substances Data) |
| Toxicity |

