206986-79-0
| Name | Chlorhexidine diacetate |
| CAS | 206986-79-0 |
| EINECS(EC#) | 205-516-1 |
| Molecular Formula | C22 H30 Cl2 N10 . 2 C2 H4 O2 . x H2 O |
| MDL Number | MFCD00150042 |
| Molecular Weight | 625.55 |
| MOL File | 206986-79-0.mol |
Chemical Properties
| Appearance | white to almost white powder |
| Melting point | 153-157°C |
| storage temp. | room temp |
| solubility | DMF: 15 mg/mL; DMSO: 15 mg/mL; DMSO:PBS(pH 7.2) (1:2): 0.33 mg/mL; Ethanol: 10 mg/mL |
| form | Powder |
| color | White to almost white |
| InChIKey | STXIUCWIIZWUGG-UHFFFAOYSA-N |
| SMILES | N(C1C=CC(Cl)=CC=1)C(=N)NC(=N)NCCCCCCNC(=N)NC(=N)NC1C=CC(Cl)=CC=1.C(=O)(O)C |
Safety Data
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H371-H410 |
| Precautionary statements | P260-P273-P301+P312-P302+P352-P305+P351+P338-P308+P311 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | DU1930000 |
| HS Code | 29280090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 2 |