
20325-40-0
| Name | 3,3'-Dimethoxybenzidine dihydrochloride |
| CAS | 20325-40-0 |
| EINECS(EC#) | 243-737-5 |
| Molecular Formula | C14H18Cl2N2O2 |
| MDL Number | MFCD00012488 |
| Molecular Weight | 317.21 |
| MOL File | 20325-40-0.mol |
Chemical Properties
| Appearance | Off-white or grey tablets |
| Melting point | 268 °C |
| Fp | 206℃ |
| storage temp. | 2-8°C |
| solubility | H2O: soluble25mg/mL |
| form | tablet |
| color | Light beige to purple-gray |
| PH | 1.7 at 20℃ and 100g/L |
| Water Solubility | 1-5 g/100 mL at 20 ºC |
| BRN | 3917996 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C14H16N2O2.ClH/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;/h3-8H,15-16H2,1-2H3;1H |
| InChIKey | UXTIAFYTYOEQHV-UHFFFAOYSA-N |
| SMILES | O(C1=C(C=CC(C2C=CC(N)=C(OC)C=2)=C1)N)C.Cl |
| CAS DataBase Reference | 20325-40-0(CAS DataBase Reference) |
| EPA Substance Registry System | 20325-40-0(EPA Substance) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | DD1050000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29222990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Eye Dam. 1 Skin Corr. 1 |
| Safety Profile |