
1184-43-6
| Name | Tetranitroblue tetrazolium chloride |
| CAS | 1184-43-6 |
| EINECS(EC#) | 214-665-1 |
| Molecular Formula | C40H32Cl2N12O10 |
| MDL Number | MFCD00036338 |
| Molecular Weight | 911.66 |
| MOL File | 1184-43-6.mol |
Chemical Properties
| Appearance | yellow to ochre to yellow-brown powder |
| Melting point | ~170 °C (dec.) |
| storage temp. | 2-8°C |
| solubility | Soluble in water, ethanol, methanol, N,Ndimethylformamide |
| form | crystals or powder |
| color | Yellow |
| Odor | Odorless |
| Water Solubility | water: 1mg/mL, clear to hazy, yellow |
| λmax | 279 nm |
| BRN | 3897475 |
| Biological Applications | Diagnosis of bacterial vaginosis; detecting alkaline phosphatase,gamma-hydroxybutyric acid (GHB),succinate dehydrogenase activity; generating and detecting reactive oxygen species; treating cancer |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | VCESGVLABVSDRO-UHFFFAOYSA-L |
| SMILES | [Cl-].[Cl-].COc1cc(ccc1-[n+]2nc(nn2-c3ccc(cc3)[N+]([O-])=O)-c4ccc(cc4)[N+]([O-])=O)-c5ccc(c(OC)c5)-[n+]6nc(nn6-c7ccc(cc7)[N+]([O-])=O)-c8ccc(cc8)[N+]([O-])=O |
| CAS DataBase Reference | 1184-43-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1184-43-6(EPA Substance) |