19437-26-4
| Name | DI-2-PYRIDYL KETONE |
| CAS | 19437-26-4 |
| EINECS(EC#) | 243-067-3 |
| Molecular Formula | C11H8N2O |
| MDL Number | MFCD00006288 |
| Molecular Weight | 184.19 |
| MOL File | 19437-26-4.mol |
Chemical Properties
| Appearance | beige to brown crystalline powder |
| Melting point | 52-55 °C (lit.) |
| Boiling point | 115-125 °C(Press: 0.1 Torr) |
| density | 1.196±0.06 g/cm3(Predicted) |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| pka | 2.30±0.10(Predicted) |
| color | Clear colorless to yellow |
| Water Solubility | Low solubility in water. |
| Detection Methods | HPLC |
| BRN | 126598 |
| InChI | InChI=1S/C11H8N2O/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10/h1-8H |
| InChIKey | QPOWUYJWCJRLEE-UHFFFAOYSA-N |
| SMILES | C(C1=NC=CC=C1)(C1=NC=CC=C1)=O |
| CAS DataBase Reference | 19437-26-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
