
19408-84-5
| Name | Dihydrocapsaicin |
| CAS | 19408-84-5 |
| EINECS(EC#) | 206-969-8 |
| Molecular Formula | C18H29NO3 |
| MDL Number | MFCD00017259 |
| Molecular Weight | 307.43 |
| MOL File | 19408-84-5.mol |
Chemical Properties
| Melting point | 62-65 °C(lit.) |
| Boiling point | 497.4±35.0 °C(Predicted) |
| density | 1.026±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | H2O: insoluble |
| form | White to off-white solid. |
| pka | 9.76±0.20(Predicted) |
| color | White to off-white |
| BRN | 2815150 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | InChI=1S/C18H29NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h10-12,14,20H,4-9,13H2,1-3H3,(H,19,21) |
| InChIKey | XJQPQKLURWNAAH-UHFFFAOYSA-N |
| SMILES | C(NCC1=CC=C(O)C(OC)=C1)(=O)CCCCCCC(C)C |
| LogP | 3.556 (est) |
| CAS DataBase Reference | 19408-84-5(CAS DataBase Reference) |
| EPA Substance Registry System | 19408-84-5(EPA Substance) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | RA8530000 |
| F | 10-21 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29399990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |