177-11-7
| Name | 1,4-Dioxa-8-azaspiro[4.5]decane |
| CAS | 177-11-7 |
| EINECS(EC#) | 205-868-6 |
| Molecular Formula | C7H13NO2 |
| MDL Number | MFCD00005976 |
| Molecular Weight | 143.18 |
| MOL File | 177-11-7.mol |
Chemical Properties
| Appearance | clear colorless to yellowish liquid |
| Boiling point | 108-111 °C26 mm Hg(lit.) |
| density | 1.117 g/mL at 20 °C(lit.) |
| refractive index | n |
| Fp | 179 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DCM, Ethyl Acetate, Methanol |
| form | Liquid |
| pka | 10.92±0.20(Predicted) |
| color | Clear colorless to yellow |
| Water Solubility | Soluble in water (Partly miscible). |
| Sensitive | Air Sensitive |
| BRN | 506799 |
| InChI | InChI=1S/C7H13NO2/c1-3-8-4-2-7(1)9-5-6-10-7/h8H,1-6H2 |
| InChIKey | KPKNTUUIEVXMOH-UHFFFAOYSA-N |
| SMILES | O1C2(CCNCC2)OCC1 |
| CAS DataBase Reference | 177-11-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Dioxa-8-azaspiro(4.5)decane(177-11-7) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10-34 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |