
17476-04-9
| Name | Lithium tri-tert-butoxyaluminum hydride |
| CAS | 17476-04-9 |
| EINECS(EC#) | 241-490-8 |
| Molecular Formula | C12H28AlLiO3 |
| MDL Number | MFCD00011532 |
| Molecular Weight | 254.27 |
| MOL File | 17476-04-9.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | 300-319 °C (dec.) (lit.) |
| Boiling point | 66°C (THF) |
| density | 0.942 g/mL at 25 °C |
| Fp | 95 °F |
| storage temp. | 2-8°C |
| solubility | It is soluble in organic solvents at low temperatures. |
| form | Solution |
| color | Clear to slightly turbid colorless |
| Stability: | Stable. Incompatible with alcohols. Reacts violently with water. Highly flammable. |
| Water Solubility | Reacts with water. |
| Sensitive | Air & Moisture Sensitive |
| BRN | 5796791 |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | 1S/3C4H9O.Al.Li.H/c3*1-4(2,3)5;;;/h3*1-3H3;;;/q3*-1;+2;+1; |
| InChIKey | BYBIDFZFKATBFH-UHFFFAOYSA-N |
| SMILES | [H][Al]([Li])(OC(C)(C)C)(OC(C)(C)C)OC(C)(C)C |
| CAS DataBase Reference | 17476-04-9(CAS DataBase Reference) |
| EPA Substance Registry System | 17476-04-9(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H260-H314 |
| Precautionary statements | P223-P231+P232-P260-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | F,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | 1 |
| RTECS | OJ5585000 |
| F | 10-21 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 4.3 |
| PackingGroup | II |
| HS Code | 29055900 |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B Water-react 1 |

