1700-02-3
| Name | 2,4-Dichloro-6-phenyl-1,3,5-triazine |
| CAS | 1700-02-3 |
| EINECS(EC#) | 216-928-6 |
| Molecular Formula | C9H5Cl2N3 |
| MDL Number | MFCD00602464 |
| Molecular Weight | 226.06 |
| MOL File | 1700-02-3.mol |
Chemical Properties
| Melting point | gt. 119.0 to 123.0 °C |
| Boiling point | 136°C/1mmHg(lit.) |
| density | 1.428±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -1.67±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C9H5Cl2N3/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6/h1-5H |
| InChIKey | AMEVJOWOWQPPJQ-UHFFFAOYSA-N |
| SMILES | N1=C(C2=CC=CC=C2)N=C(Cl)N=C1Cl |
| CAS DataBase Reference | 1700-02-3(CAS DataBase Reference) |
| Description | |
| Odor | White to off-white powder |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933998090 |
