1689-89-0
| Name | Nitroxinil |
| CAS | 1689-89-0 |
| EINECS(EC#) | 216-884-8 |
| Molecular Formula | C7H3IN2O3 |
| MDL Number | MFCD00070776 |
| Molecular Weight | 290.01 |
| MOL File | 1689-89-0.mol |
Chemical Properties
| Melting point | 137-138° |
| Boiling point | 280.1±40.0 °C(Predicted) |
| density | 2.1385 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 3.00±0.38(Predicted) |
| color | Off-white to light yellow |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C7H3IN2O3/c8-5-1-4(3-9)2-6(7(5)11)10(12)13/h1-2,11H |
| InChIKey | SGKGVABHDAQAJO-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC([N+]([O-])=O)=C(O)C(I)=C1 |
| CAS DataBase Reference | 1689-89-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Nitroxinil(1689-89-0) |
| EPA Substance Registry System | 1689-89-0(EPA Substance) |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DI4600000 |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity |
;