1640-39-7
| Name | 2,3,3-Trimethylindolenine |
| CAS | 1640-39-7 |
| EINECS(EC#) | 216-685-6 |
| Molecular Formula | C11H13N |
| MDL Number | MFCD00005724 |
| Molecular Weight | 159.23 |
| MOL File | 1640-39-7.mol |
Chemical Properties
| Appearance | clear yellow to red-brown liquid |
| Melting point | 6-8°C |
| Boiling point | 228-229 °C744 mm Hg(lit.) |
| density | 0.992 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 200 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform, toluene or dichlorobenzene. |
| form | Liquid |
| pka | 6.33±0.40(Predicted) |
| color | Clear yellow to red-brown |
| BRN | 119740 |
| InChI | InChI=1S/C11H13N/c1-8-11(2,3)9-6-4-5-7-10(9)12-8/h4-7H,1-3H3 |
| InChIKey | FLHJIAFUWHPJRT-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C)(C)C=1C |
| CAS DataBase Reference | 1640-39-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 3H-Indole, 2,3,3-trimethyl-(1640-39-7) |
| EPA Substance Registry System | 1640-39-7(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 1 |
| F | 10 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |