
41532-84-7
| Name | 1,1,2-Trimethyl-1H-benz[e]indole |
| CAS | 41532-84-7 |
| EINECS(EC#) | 255-429-8 |
| Molecular Formula | C15H15N |
| MDL Number | MFCD00082627 |
| Molecular Weight | 209.29 |
| MOL File | 41532-84-7.mol |
Chemical Properties
| Appearance | yellow to brown crystalline powder |
| Melting point | 111-117 °C |
| Boiling point | 338.66°C (rough estimate) |
| density | 0.7 |
| refractive index | 1.5720 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | insoluble (20°C) |
| form | Crystalline Powder |
| pka | 5.77±0.40(Predicted) |
| color | Yellow to brown |
| Water Solubility | insoluble (20 ºC) |
| Detection Methods | HPLC,NMR |
| BRN | 153709 |
| InChI | InChI=1S/C15H15N/c1-10-15(2,3)14-12-7-5-4-6-11(12)8-9-13(14)16-10/h4-9H,1-3H3 |
| InChIKey | WJZSZXCWMATYFX-UHFFFAOYSA-N |
| SMILES | N1C2=C(C3=CC=CC=C3C=C2)C(C)(C)C=1C |
| CAS DataBase Reference | 41532-84-7(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
| EPA Substance Registry System | 1H-Benz[e]indole, 1,1,2-trimethyl- (41532-84-7) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
