
1497-49-0
| Name | Glutacondianil hydrochloride |
| CAS | 1497-49-0 |
| EINECS(EC#) | 216-094-3 |
| Molecular Formula | C17H17ClN2 |
| MDL Number | MFCD00012630 |
| Molecular Weight | 284.78 |
| MOL File | 1497-49-0.mol |
Chemical Properties
| Appearance | bordeaux to purple powder |
| Melting point | 152 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Powder |
| color | Bordeaux to purple |
| Water Solubility | Soluble in methanol. Insoluble in water.. |
| Sensitive | Hygroscopic |
| BRN | 3916924 |
| Stability: | Hygroscopic |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C17H16N2.ClH/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17;/h1-15,18H;1H/b9-3+,14-8+,19-15+; |
| InChIKey | VUCMMJBDNXZQDJ-SAIFEKGMSA-N |
| SMILES | C1(N/C=C/C=C/C=N/C2C=CC=CC=2)C=CC=CC=1.Cl |
| CAS DataBase Reference | 1497-49-0(CAS DataBase Reference) |
| EPA Substance Registry System | 1497-49-0(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
