
16110-09-1
| Name | 2,5-Dichloropyridine |
| CAS | 16110-09-1 |
| EINECS(EC#) | 240-278-2 |
| Molecular Formula | C5H3Cl2N |
| MDL Number | MFCD00006239 |
| Molecular Weight | 147.99 |
| MOL File | 16110-09-1.mol |
Chemical Properties
| Appearance | white to slightly yellow crystalline solid |
| Melting point | 59-62 °C (lit.) |
| Boiling point | 190-191 °C |
| density | 1.5159 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Fp | 112 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Solid |
| pka | -2.25±0.10(Predicted) |
| color | White to slightly yellow |
| Water Solubility | insoluble |
| BRN | 108886 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-2-5(7)8-3-4/h1-3H |
| InChIKey | GCTFDMFLLBCLPF-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Cl)C=C1 |
| CAS DataBase Reference | 16110-09-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | US8225000 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
