2457-47-8
| Name | 3,5-Dichloropyridine |
| CAS | 2457-47-8 |
| EINECS(EC#) | 219-537-9 |
| Molecular Formula | C5H3Cl2N |
| MDL Number | MFCD00006376 |
| Molecular Weight | 147.99 |
| MOL File | 2457-47-8.mol |
Chemical Properties
| Appearance | White to yellow powder |
| Melting point | 65-67 °C (lit.) |
| Boiling point | 178 °C |
| density | 1.39 |
| Fp | >110°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Ethyl Acetate |
| form | Solid |
| pka | 0.32±0.10(Predicted) |
| color | White to Off-White |
| BRN | 1973 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| InChIKey | WPGHPGAUFIJVJF-UHFFFAOYSA-N |
| SMILES | C1=NC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 2457-47-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine, 3,5-dichloro-(2457-47-8) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | US8575000 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |