
15985-39-4
| Name | L-METHIONINE SULFOXIMINE |
| CAS | 15985-39-4 |
| EINECS(EC#) | 629-483-1 |
| Molecular Formula | C5H12N2O3S |
| MDL Number | MFCD00002621 |
| Molecular Weight | 180.23 |
| MOL File | 15985-39-4.mol |
Chemical Properties
| Appearance | White Crystalline Powder |
| Melting point | >210 °C (dec.)(lit.) |
| Boiling point | 352.2±52.0 °C(Predicted) |
| density | 1.215 (estimate) |
| refractive index | 1.6430 (estimate) |
| storage temp. | 0-6°C |
| solubility | Aqueous Base (Slightly), Formic Acid (Slightly), Water (Sparingly, Sonicated) |
| form | Crystalline Powder |
| color | White or almost white |
| biological source | synthetic |
| Optical Rotation | [α]20/D +10.8 to +14.0°, c = 1 in H2O |
| Usage | Methionine sulfoximine inhibits both glutamine synthetase and g-glutamylcysteine synthetase. Working concentrations for inhibition of g-glutamylcysteine synthetase are 0.2-2.0 mM (52% inhibition occured at 100 mM). Methionine sulfoximine is also |
| BRN | 6175446 |
| Stability: | Temperature Sensitive |
| InChI | InChI=1S/C5H12N2O3S/c1-11(7,10)3-2-4(6)5(8)9/h4,7H,2-3,6H2,1H3,(H,8,9)/t4-,11?/m0/s1 |
| InChIKey | SXTAYKAGBXMACB-DPVSGNNYSA-N |
| SMILES | C(O)(=O)[C@@H](N)CCS(C)(=O)=N |
| CAS DataBase Reference | 15985-39-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
