1592-70-7
| Name | 4-Vinylbenzylchloride |
| CAS | 1592-70-7 |
| Molecular Formula | C16H12O6 |
| MDL Number | MFCD18450728 |
| Molecular Weight | 300.26 |
| MOL File | 1592-70-7.mol |
Chemical Properties
| Melting point | >300℃ |
| Boiling point | 586.2±50.0 °C(Predicted) |
| density | 1.58±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| form | solid |
| pka | 6.34±0.40(Predicted) |
| color | Light yellow to yellow |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| InChI | 1S/C16H12O6/c1-21-16-14(20)13-11(19)6-10(18)7-12(13)22-15(16)8-2-4-9(17)5-3-8/h2-7,17-19H,1H3 |
| InChIKey | VJJZJBUCDWKPLC-UHFFFAOYSA-N |
| SMILES | COC1=C(Oc2cc(O)cc(O)c2C1=O)c3ccc(O)cc3 |
| LogP | 2.220 (est) |
Safety Data
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |