156311-83-0
| Name | (3-Hydroxy-3H-1,2,3-triazolo[4,5-b]pyridinato-O)tri-1-pyrrolidinylphosphonium hexafluorophosphate |
| CAS | 156311-83-0 |
| EINECS(EC#) | 627-192-4 |
| Molecular Formula | C17H27F6N7OP2 |
| MDL Number | MFCD03703417 |
| Molecular Weight | 521.38 |
| MOL File | 156311-83-0.mol |
Chemical Properties
| Melting point | 163-168 °C(lit.) |
| RTECS | TH3890000 |
| storage temp. | -20°C |
| solubility | Soluble in water or 1% acetic acid |
| form | Powder or Crystalline Powder |
| color | White to off-white |
| Water Solubility | Soluble in water. |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C17H27N7OP.F6P/c1-2-11-21(10-1)26(22-12-3-4-13-22,23-14-5-6-15-23)25-24-17-16(19-20-24)8-7-9-18-17;1-7(2,3,4,5)6/h7-9H,1-6,10-15H2;/q+1;-1 |
| InChIKey | CBZAHNDHLWAZQC-UHFFFAOYSA-N |
| SMILES | [P+5]([F-])([F-])([F-])([F-])([F-])[F-].[P+](N1CCCC1)(N1CCCC1)(N1CCCC1)ON1N=NC2C=CC=NC1=2 |
| CAS DataBase Reference | 156311-83-0(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphorus(1+), [3-(hydroxy-.kappa.O)-3H-1,2,3-triazolo[4,5-b]pyridinato]tri-1-pyrrolidinyl-, (T-4)-, hexafluorophosphate(1-) (1:1) (156311-83-0) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
![Synthetic route of (3-Hydroxy-3H-1,2,3-triazolo[4,5-b]pyridinato-O)tri-1-pyrrolidinylphosphonium hexafluorophosphate](/NewsImg/2023-06-19/6382276420950870801220790.jpg "Synthetic route of (3-Hydroxy-3H-1,2,3-triazolo[4,5-b]pyridinato-O)tri-1-pyrrolidinylphosphonium hexafluorophosphate")