149-11-1
| Name | Copper bis(2-ethylhexanoate) |
| CAS | 149-11-1 |
| EINECS(EC#) | 205-731-0 |
| Molecular Formula | C16H30CuO4 |
| MDL Number | MFCD00015695 |
| Molecular Weight | 349.95 |
| MOL File | 149-11-1.mol |
Chemical Properties
| Appearance | BLUE-GREEN POWDER |
| Melting point | 252 °C (dec.)(lit.) |
| storage temp. | Storage temp. 2-8°C |
| form | Powder |
| color | blue |
| Water Solubility | Soluble in water, alcohols, dichloroethane, chlorobenzene, and most organic solvents. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3 |
| InChI | InChI=1S/2C8H16O2.Cu/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | SEKCXMNFUDONGJ-UHFFFAOYSA-L |
| SMILES | C(CC)(CCCC)C(=O)O[Cu]OC(=O)C(CC)CCCC |
| CAS DataBase Reference | 149-11-1(CAS DataBase Reference) |
| EPA Substance Registry System | 149-11-1(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |